C16H34N2 — CID 81467256
N-decyl-1,5-dimethylpyrrolidin-3-amine (PubChem CID 81467256) has the molecular formula C16H34N2 and a molecular weight of 254.46 g/mol. Its IUPAC name is N-decyl-1,5-dimethylpyrrolidin-3-amine.
| Compound Name | N-decyl-1,5-dimethylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 81467256 |
| Molecular Formula | C16H34N2 |
| Molecular Weight | 254.46 g/mol |
| Exact Mass | 254.27 |
| IUPAC Name | N-decyl-1,5-dimethylpyrrolidin-3-amine |
| SMILES | CCCCCCCCCCNC1CC(C)N(C)C1 |
| InChI | InChI=1S/C16H34N2/c1-4-5-6-7-8-9-10-11-12-17-16-13-15(2)18(3)14-16/h15-17H,4-14H2,1-3H3 |
| InChIKey | NZLQHEZGFATAQX-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.46 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|