C8H18N2 — CID 166869669
(5R)-N,N,1,5-tetramethylpyrrolidin-3-amine (PubChem CID 166869669) has the molecular formula C8H18N2 and a molecular weight of 142.24 g/mol. Its IUPAC name is (5R)-N,N,1,5-tetramethylpyrrolidin-3-amine.
| Compound Name | (5R)-N,N,1,5-tetramethylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 166869669 |
| Molecular Formula | C8H18N2 |
| Molecular Weight | 142.24 g/mol |
| Exact Mass | 142.15 |
| IUPAC Name | (5R)-N,N,1,5-tetramethylpyrrolidin-3-amine |
| SMILES | C[C@@H]1CC(CN1C)N(C)C |
| InChI | InChI=1S/C8H18N2/c1-7-5-8(9(2)3)6-10(7)4/h7-8H,5-6H2,1-4H3/t7-,8?/m1/s1 |
| InChIKey | WHHJIWGONVVIFZ-GVHYBUMESA-N |
| XLogP | 0.90 |
| TPSA | 6.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | 112 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.24 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |