C9H21NO — CID 166533533
methoxymethane;1,2,4-trimethylpyrrolidine (PubChem CID 166533533) has the molecular formula C9H21NO and a molecular weight of 159.27 g/mol. Its IUPAC name is methoxymethane;1,2,4-trimethylpyrrolidine.
| Compound Name | methoxymethane;1,2,4-trimethylpyrrolidine |
|---|---|
| PubChem CID | 166533533 |
| Molecular Formula | C9H21NO |
| Molecular Weight | 159.27 g/mol |
| Exact Mass | 159.16 |
| IUPAC Name | methoxymethane;1,2,4-trimethylpyrrolidine |
| SMILES | CC1CC(C)N(C)C1.COC |
| InChI | InChI=1S/C7H15N.C2H6O/c1-6-4-7(2)8(3)5-6;1-3-2/h6-7H,4-5H2,1-3H3;1-2H3 |
| InChIKey | IXPRRKOETWFFFN-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.27 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |