C8H17NO — CID 67681529
(2R)-4-(methoxymethyl)-1,2-dimethylpyrrolidine (PubChem CID 67681529) has the molecular formula C8H17NO and a molecular weight of 143.23 g/mol. Its IUPAC name is (2R)-4-(methoxymethyl)-1,2-dimethylpyrrolidine.
| Compound Name | (2R)-4-(methoxymethyl)-1,2-dimethylpyrrolidine |
|---|---|
| PubChem CID | 67681529 |
| Molecular Formula | C8H17NO |
| Molecular Weight | 143.23 g/mol |
| Exact Mass | 143.13 |
| IUPAC Name | (2R)-4-(methoxymethyl)-1,2-dimethylpyrrolidine |
| SMILES | COCC1C[C@@H](C)N(C)C1 |
| InChI | InChI=1S/C8H17NO/c1-7-4-8(6-10-3)5-9(7)2/h7-8H,4-6H2,1-3H3/t7-,8?/m1/s1 |
| InChIKey | JFYIAHYCTIUEEU-GVHYBUMESA-N |
| XLogP | 0.97 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.23 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |