C9H20N2O2 — CID 82714770
N-(2-methoxyethoxy)-1,5-dimethylpyrrolidin-3-amine (PubChem CID 82714770) has the molecular formula C9H20N2O2 and a molecular weight of 188.27 g/mol. Its IUPAC name is N-(2-methoxyethoxy)-1,5-dimethylpyrrolidin-3-amine.
| Compound Name | N-(2-methoxyethoxy)-1,5-dimethylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 82714770 |
| Molecular Formula | C9H20N2O2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.15 |
| IUPAC Name | N-(2-methoxyethoxy)-1,5-dimethylpyrrolidin-3-amine |
| SMILES | COCCONC1CC(C)N(C)C1 |
| InChI | InChI=1S/C9H20N2O2/c1-8-6-9(7-11(8)2)10-13-5-4-12-3/h8-10H,4-7H2,1-3H3 |
| InChIKey | XULZCRAXINVYLE-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|