About 4-heptyl-1,2-dimethylpyrrolidine
4-heptyl-1,2-dimethylpyrrolidine (PubChem CID 177227057) has the molecular formula C13H27N
and a molecular weight of 197.37 g/mol. Its IUPAC name is 4-heptyl-1,2-dimethylpyrrolidine.
Molecular Properties
| Compound Name | 4-heptyl-1,2-dimethylpyrrolidine |
| PubChem CID | 177227057 |
| Molecular Formula | C13H27N |
| Molecular Weight | 197.37 g/mol |
| Exact Mass | 197.21 |
| IUPAC Name | 4-heptyl-1,2-dimethylpyrrolidine |
| SMILES | CCCCCCCC1CC(C)N(C)C1 |
| InChI | InChI=1S/C13H27N/c1-4-5-6-7-8-9-13-10-12(2)14(3)11-13/h12-13H,4-11H2,1-3H3 |
| InChIKey | DOORMRPFMOGDEE-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.37 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-heptyl-1,2-dimethylpyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-heptyl-1,2-dimethylpyrrolidine?
The IUPAC name of 4-heptyl-1,2-dimethylpyrrolidine (CID 177227057) is 4-heptyl-1,2-dimethylpyrrolidine.
What is the SMILES notation for 4-heptyl-1,2-dimethylpyrrolidine?
The canonical SMILES for 4-heptyl-1,2-dimethylpyrrolidine is CCCCCCCC1CC(C)N(C)C1.
What is the InChIKey of 4-heptyl-1,2-dimethylpyrrolidine?
The InChIKey is DOORMRPFMOGDEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H27N/c1-4-5-6-7-8-9-13-10-12(2)14(3)11-13/h12-13H,4-11H2,1-3H3.
What are the key properties of 4-heptyl-1,2-dimethylpyrrolidine?
4-heptyl-1,2-dimethylpyrrolidine has a molecular weight of 197.37 g/mol, XLogP of 3.69, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-heptyl-1,2-dimethylpyrrolidine is sourced from PubChem (CID 177227057), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).