About 4-ethyl-2-heptyl-1,6-dimethylpiperidine
4-ethyl-2-heptyl-1,6-dimethylpiperidine (PubChem CID 22754520) has the molecular formula C16H33N
and a molecular weight of 239.45 g/mol. Its IUPAC name is 4-ethyl-2-heptyl-1,6-dimethylpiperidine.
Molecular Properties
| Compound Name | 4-ethyl-2-heptyl-1,6-dimethylpiperidine |
| PubChem CID | 22754520 |
| Molecular Formula | C16H33N |
| Molecular Weight | 239.45 g/mol |
| Exact Mass | 239.26 |
| IUPAC Name | 4-ethyl-2-heptyl-1,6-dimethylpiperidine |
| SMILES | CCCCCCCC1CC(CC)CC(C)N1C |
| InChI | InChI=1S/C16H33N/c1-5-7-8-9-10-11-16-13-15(6-2)12-14(3)17(16)4/h14-16H,5-13H2,1-4H3 |
| InChIKey | IMBJLDUKTUXATF-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.45 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-ethyl-2-heptyl-1,6-dimethylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-2-heptyl-1,6-dimethylpiperidine?
The IUPAC name of 4-ethyl-2-heptyl-1,6-dimethylpiperidine (CID 22754520) is 4-ethyl-2-heptyl-1,6-dimethylpiperidine.
What is the SMILES notation for 4-ethyl-2-heptyl-1,6-dimethylpiperidine?
The canonical SMILES for 4-ethyl-2-heptyl-1,6-dimethylpiperidine is CCCCCCCC1CC(CC)CC(C)N1C.
What is the InChIKey of 4-ethyl-2-heptyl-1,6-dimethylpiperidine?
The InChIKey is IMBJLDUKTUXATF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H33N/c1-5-7-8-9-10-11-16-13-15(6-2)12-14(3)17(16)4/h14-16H,5-13H2,1-4H3.
What are the key properties of 4-ethyl-2-heptyl-1,6-dimethylpiperidine?
4-ethyl-2-heptyl-1,6-dimethylpiperidine has a molecular weight of 239.45 g/mol, XLogP of 4.86, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-2-heptyl-1,6-dimethylpiperidine is sourced from PubChem (CID 22754520), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).