C9H19NO — CID 125449850
(2R,4R,6R)-4-ethyl-1,6-dimethylpiperidin-2-ol (PubChem CID 125449850) has the molecular formula C9H19NO and a molecular weight of 157.26 g/mol. Its IUPAC name is (2R,4R,6R)-4-ethyl-1,6-dimethylpiperidin-2-ol.
| Compound Name | (2R,4R,6R)-4-ethyl-1,6-dimethylpiperidin-2-ol |
|---|---|
| PubChem CID | 125449850 |
| Molecular Formula | C9H19NO |
| Molecular Weight | 157.26 g/mol |
| Exact Mass | 157.15 |
| IUPAC Name | (2R,4R,6R)-4-ethyl-1,6-dimethylpiperidin-2-ol |
| SMILES | CC[C@@H]1C[C@@H](C)N(C)[C@H](O)C1 |
| InChI | InChI=1S/C9H19NO/c1-4-8-5-7(2)10(3)9(11)6-8/h7-9,11H,4-6H2,1-3H3/t7-,8-,9-/m1/s1 |
| InChIKey | MUUAEFOOIHTCCM-IWSPIJDZSA-N |
| XLogP | 1.45 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.26 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |