C8H14 — CID 154521866
(1S,5R)-3-ethylbicyclo[3.1.0]hexane (PubChem CID 154521866) has the molecular formula C8H14 and a molecular weight of 110.20 g/mol. Its IUPAC name is (1S,5R)-3-ethylbicyclo[3.1.0]hexane.
| Compound Name | (1S,5R)-3-ethylbicyclo[3.1.0]hexane |
|---|---|
| PubChem CID | 154521866 |
| Molecular Formula | C8H14 |
| Molecular Weight | 110.20 g/mol |
| Exact Mass | 110.11 |
| IUPAC Name | (1S,5R)-3-ethylbicyclo[3.1.0]hexane |
| SMILES | CCC1C[C@@H]2C[C@@H]2C1 |
| InChI | InChI=1S/C8H14/c1-2-6-3-7-5-8(7)4-6/h6-8H,2-5H2,1H3/t6?,7-,8+ |
| InChIKey | WWDABSPKHWIPAN-IEESLHIDSA-N |
| XLogP | 2.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 110.20 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |