C9H16 — CID 143706776
(1S,3S)-3-ethylbicyclo[4.1.0]heptane (PubChem CID 143706776) has the molecular formula C9H16 and a molecular weight of 124.23 g/mol. Its IUPAC name is (1S,3S)-3-ethylbicyclo[4.1.0]heptane.
| Compound Name | (1S,3S)-3-ethylbicyclo[4.1.0]heptane |
|---|---|
| PubChem CID | 143706776 |
| Molecular Formula | C9H16 |
| Molecular Weight | 124.23 g/mol |
| Exact Mass | 124.13 |
| IUPAC Name | (1S,3S)-3-ethylbicyclo[4.1.0]heptane |
| SMILES | CC[C@H]1CCC2C[C@H]2C1 |
| InChI | InChI=1S/C9H16/c1-2-7-3-4-8-6-9(8)5-7/h7-9H,2-6H2,1H3/t7-,8?,9+/m0/s1 |
| InChIKey | ZAOYLIFCCRJTRE-UBGVJBJISA-N |
| XLogP | 2.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 124.23 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |