C13H21N — CID 54020010
(2R,4aR)-6-ethyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-2-carbonitrile (PubChem CID 54020010) has the molecular formula C13H21N and a molecular weight of 191.32 g/mol. Its IUPAC name is (2R,4aR)-6-ethyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-2-carbonitrile.
| Compound Name | (2R,4aR)-6-ethyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-2-carbonitrile |
|---|---|
| PubChem CID | 54020010 |
| Molecular Formula | C13H21N |
| Molecular Weight | 191.32 g/mol |
| Exact Mass | 191.17 |
| IUPAC Name | (2R,4aR)-6-ethyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-2-carbonitrile |
| SMILES | CCC1CCC2C[C@H](C#N)CC[C@@H]2C1 |
| InChI | InChI=1S/C13H21N/c1-2-10-3-5-13-8-11(9-14)4-6-12(13)7-10/h10-13H,2-8H2,1H3/t10?,11-,12-,13?/m1/s1 |
| InChIKey | KYGOVPQNJRAZIB-QZQSVVMZSA-N |
| XLogP | 3.75 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.32 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |