C13H24 — CID 177020606
(3aS,6aR)-2-ethyl-5-propan-2-yl-1,2,3,3a,4,5,6,6a-octahydropentalene (PubChem CID 177020606) has the molecular formula C13H24 and a molecular weight of 180.33 g/mol. Its IUPAC name is (3aS,6aR)-2-ethyl-5-propan-2-yl-1,2,3,3a,4,5,6,6a-octahydropentalene.
| Compound Name | (3aS,6aR)-2-ethyl-5-propan-2-yl-1,2,3,3a,4,5,6,6a-octahydropentalene |
|---|---|
| PubChem CID | 177020606 |
| Molecular Formula | C13H24 |
| Molecular Weight | 180.33 g/mol |
| Exact Mass | 180.19 |
| IUPAC Name | (3aS,6aR)-2-ethyl-5-propan-2-yl-1,2,3,3a,4,5,6,6a-octahydropentalene |
| SMILES | CCC1C[C@@H]2CC(C(C)C)C[C@@H]2C1 |
| InChI | InChI=1S/C13H24/c1-4-10-5-12-7-11(9(2)3)8-13(12)6-10/h9-13H,4-8H2,1-3H3/t10?,11?,12-,13+ |
| InChIKey | WKWAFRYDOGKSLC-BPNZPQAUSA-N |
| XLogP | 4.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.33 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |