C4H7Cl — CID 130909377
cis-(1S,2R)-1-chloro-2-methylcyclopropane (PubChem CID 130909377) has the molecular formula C4H7Cl and a molecular weight of 90.55 g/mol. Its IUPAC name is cis-(1S,2R)-1-chloro-2-methylcyclopropane.
| Compound Name | cis-(1S,2R)-1-chloro-2-methylcyclopropane |
|---|---|
| PubChem CID | 130909377 |
| Molecular Formula | C4H7Cl |
| Molecular Weight | 90.55 g/mol |
| Exact Mass | 90.02 |
| IUPAC Name | cis-(1S,2R)-1-chloro-2-methylcyclopropane |
| SMILES | C[C@@H]1C[C@@H]1Cl |
| InChI | InChI=1S/C4H7Cl/c1-3-2-4(3)5/h3-4H,2H2,1H3/t3-,4+/m1/s1 |
| InChIKey | KQYTYGONQSPCFT-DMTCNVIQSA-N |
| XLogP | 1.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 90.55 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|