C6H8Cl4 — CID 91753323
(1S,2S,4S,5S)-1,2,4,5-tetrachlorocyclohexane (PubChem CID 91753323) has the molecular formula C6H8Cl4 and a molecular weight of 221.94 g/mol. Its IUPAC name is (1S,2S,4S,5S)-1,2,4,5-tetrachlorocyclohexane.
| Compound Name | (1S,2S,4S,5S)-1,2,4,5-tetrachlorocyclohexane |
|---|---|
| PubChem CID | 91753323 |
| Molecular Formula | C6H8Cl4 |
| Molecular Weight | 221.94 g/mol |
| Exact Mass | 219.94 |
| IUPAC Name | (1S,2S,4S,5S)-1,2,4,5-tetrachlorocyclohexane |
| SMILES | Cl[C@H]1C[C@H](Cl)[C@@H](Cl)C[C@@H]1Cl |
| InChI | InChI=1S/C6H8Cl4/c7-3-1-4(8)6(10)2-5(3)9/h3-6H,1-2H2/t3-,4-,5-,6-/m0/s1 |
| InChIKey | WCKYEVXZTBRMIY-BXKVDMCESA-N |
| XLogP | 3.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.94 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|