About 4-bromo-2,6-dichlorocyclohexan-1-ol
4-bromo-2,6-dichlorocyclohexan-1-ol (PubChem CID 44558065) has the molecular formula C6H9BrCl2O
and a molecular weight of 247.95 g/mol. Its IUPAC name is 4-bromo-2,6-dichlorocyclohexan-1-ol.
Molecular Properties
| Compound Name | 4-bromo-2,6-dichlorocyclohexan-1-ol |
| PubChem CID | 44558065 |
| Molecular Formula | C6H9BrCl2O |
| Molecular Weight | 247.95 g/mol |
| Exact Mass | 245.92 |
| IUPAC Name | 4-bromo-2,6-dichlorocyclohexan-1-ol |
| SMILES | OC1C(Cl)CC(Br)CC1Cl |
| InChI | InChI=1S/C6H9BrCl2O/c7-3-1-4(8)6(10)5(9)2-3/h3-6,10H,1-2H2 |
| InChIKey | ZANIFLJPFADINN-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.95 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-bromo-2,6-dichlorocyclohexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-2,6-dichlorocyclohexan-1-ol?
The IUPAC name of 4-bromo-2,6-dichlorocyclohexan-1-ol (CID 44558065) is 4-bromo-2,6-dichlorocyclohexan-1-ol.
What is the SMILES notation for 4-bromo-2,6-dichlorocyclohexan-1-ol?
The canonical SMILES for 4-bromo-2,6-dichlorocyclohexan-1-ol is OC1C(Cl)CC(Br)CC1Cl.
What is the InChIKey of 4-bromo-2,6-dichlorocyclohexan-1-ol?
The InChIKey is ZANIFLJPFADINN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9BrCl2O/c7-3-1-4(8)6(10)5(9)2-3/h3-6,10H,1-2H2.
What are the key properties of 4-bromo-2,6-dichlorocyclohexan-1-ol?
4-bromo-2,6-dichlorocyclohexan-1-ol has a molecular weight of 247.95 g/mol, XLogP of 2.12, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-2,6-dichlorocyclohexan-1-ol is sourced from PubChem (CID 44558065), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).