C6H9BrCl2O — CID 44558065
4-bromo-2,6-dichlorocyclohexan-1-ol (PubChem CID 44558065) has the molecular formula C6H9BrCl2O and a molecular weight of 247.95 g/mol. Its IUPAC name is 4-bromo-2,6-dichlorocyclohexan-1-ol.
| Compound Name | 4-bromo-2,6-dichlorocyclohexan-1-ol |
|---|---|
| PubChem CID | 44558065 |
| Molecular Formula | C6H9BrCl2O |
| Molecular Weight | 247.95 g/mol |
| Exact Mass | 245.92 |
| IUPAC Name | 4-bromo-2,6-dichlorocyclohexan-1-ol |
| SMILES | OC1C(Cl)CC(Br)CC1Cl |
| InChI | InChI=1S/C6H9BrCl2O/c7-3-1-4(8)6(10)5(9)2-3/h3-6,10H,1-2H2 |
| InChIKey | ZANIFLJPFADINN-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.95 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|