C6H11BrO3 — CID 130020622
5-bromocyclohexane-1,2,3-triol (PubChem CID 130020622) has the molecular formula C6H11BrO3 and a molecular weight of 211.05 g/mol. Its IUPAC name is 5-bromocyclohexane-1,2,3-triol.
| Compound Name | 5-bromocyclohexane-1,2,3-triol |
|---|---|
| PubChem CID | 130020622 |
| Molecular Formula | C6H11BrO3 |
| Molecular Weight | 211.05 g/mol |
| Exact Mass | 209.99 |
| IUPAC Name | 5-bromocyclohexane-1,2,3-triol |
| SMILES | OC1CC(Br)CC(O)C1O |
| InChI | InChI=1S/C6H11BrO3/c7-3-1-4(8)6(10)5(9)2-3/h3-6,8-10H,1-2H2 |
| InChIKey | GHHOPJCDDUGPCW-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.05 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|