C10H16O3 — CID 13191206
tricyclo[5.2.1.02,6]decane-3,4,9-triol (PubChem CID 13191206) has the molecular formula C10H16O3 and a molecular weight of 184.23 g/mol. Its IUPAC name is tricyclo[5.2.1.02,6]decane-3,4,9-triol.
| Compound Name | tricyclo[5.2.1.02,6]decane-3,4,9-triol |
|---|---|
| PubChem CID | 13191206 |
| Molecular Formula | C10H16O3 |
| Molecular Weight | 184.23 g/mol |
| Exact Mass | 184.11 |
| IUPAC Name | tricyclo[5.2.1.02,6]decane-3,4,9-triol |
| SMILES | OC1CC2C3CC(O)C(C3)C2C1O |
| InChI | InChI=1S/C10H16O3/c11-7-2-4-1-6(7)9-5(4)3-8(12)10(9)13/h4-13H,1-3H2 |
| InChIKey | AKMSEFVQQNUOFA-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.23 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |