C7H11O5- — CID 153412779
3,4,5-trihydroxycyclohexane-1-carboxylate (PubChem CID 153412779) has the molecular formula C7H11O5- and a molecular weight of 175.16 g/mol. Its IUPAC name is 3,4,5-trihydroxycyclohexane-1-carboxylate.
| Compound Name | 3,4,5-trihydroxycyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 153412779 |
| Molecular Formula | C7H11O5- |
| Molecular Weight | 175.16 g/mol |
| Exact Mass | 175.06 |
| IUPAC Name | 3,4,5-trihydroxycyclohexane-1-carboxylate |
| SMILES | O=C([O-])C1CC(O)C(O)C(O)C1 |
| InChI | InChI=1S/C7H12O5/c8-4-1-3(7(11)12)2-5(9)6(4)10/h3-6,8-10H,1-2H2,(H,11,12)/p-1 |
| InChIKey | SOWVWGZSLABJMC-UHFFFAOYSA-M |
| XLogP | -2.77 |
| TPSA | 100.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.16 |
| LogP ≤ 5 | -2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |