C9H15NO6 — CID 139145721
azanium cis-(3R,5S)-3,5-dicarboxycyclohexane-1-carboxylate (PubChem CID 139145721) has the molecular formula C9H15NO6 and a molecular weight of 233.22 g/mol. Its IUPAC name is azanium cis-(3R,5S)-3,5-dicarboxycyclohexane-1-carboxylate.
| Compound Name | azanium cis-(3R,5S)-3,5-dicarboxycyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 139145721 |
| Molecular Formula | C9H15NO6 |
| Molecular Weight | 233.22 g/mol |
| Exact Mass | 233.09 |
| IUPAC Name | azanium cis-(3R,5S)-3,5-dicarboxycyclohexane-1-carboxylate |
| SMILES | O=C([O-])C1C[C@@H](C(=O)O)C[C@@H](C(=O)O)C1.[NH4+] |
| InChI | InChI=1S/C9H12O6.H3N/c10-7(11)4-1-5(8(12)13)3-6(2-4)9(14)15;/h4-6H,1-3H2,(H,10,11)(H,12,13)(H,14,15);1H3 |
| InChIKey | GAGSIBZKBJYWSD-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 151.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.22 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |