About azetidine-3-carboxylate
azetidine-3-carboxylate (PubChem CID 19814779) has the molecular formula C4H6NO2-
and a molecular weight of 100.10 g/mol. Its IUPAC name is azetidine-3-carboxylate.
Molecular Properties
| Compound Name | azetidine-3-carboxylate |
| PubChem CID | 19814779 |
| Molecular Formula | C4H6NO2- |
| Molecular Weight | 100.10 g/mol |
| Exact Mass | 100.04 |
| IUPAC Name | azetidine-3-carboxylate |
| SMILES | O=C([O-])C1CNC1 |
| InChI | InChI=1S/C4H7NO2/c6-4(7)3-1-5-2-3/h3,5H,1-2H2,(H,6,7)/p-1 |
| InChIKey | GFZWHAAOIVMHOI-UHFFFAOYSA-M |
| XLogP | -2.04 |
| TPSA | 52.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 100.10 |
| LogP ≤ 5 | -2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze azetidine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azetidine-3-carboxylate?
The IUPAC name of azetidine-3-carboxylate (CID 19814779) is azetidine-3-carboxylate.
What is the SMILES notation for azetidine-3-carboxylate?
The canonical SMILES for azetidine-3-carboxylate is O=C([O-])C1CNC1.
What is the InChIKey of azetidine-3-carboxylate?
The InChIKey is GFZWHAAOIVMHOI-UHFFFAOYSA-M. The full InChI is InChI=1S/C4H7NO2/c6-4(7)3-1-5-2-3/h3,5H,1-2H2,(H,6,7)/p-1.
What are the key properties of azetidine-3-carboxylate?
azetidine-3-carboxylate has a molecular weight of 100.10 g/mol, XLogP of -2.04, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azetidine-3-carboxylate is sourced from PubChem (CID 19814779), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).