About azetidine-3-carbonyl chloride
azetidine-3-carbonyl chloride (PubChem CID 154252527) has the molecular formula C4H6ClNO
and a molecular weight of 119.55 g/mol. Its IUPAC name is azetidine-3-carbonyl chloride.
Molecular Properties
| Compound Name | azetidine-3-carbonyl chloride |
| PubChem CID | 154252527 |
| Molecular Formula | C4H6ClNO |
| Molecular Weight | 119.55 g/mol |
| Exact Mass | 119.01 |
| IUPAC Name | azetidine-3-carbonyl chloride |
| SMILES | O=C(Cl)C1CNC1 |
| InChI | InChI=1S/C4H6ClNO/c5-4(7)3-1-6-2-3/h3,6H,1-2H2 |
| InChIKey | HEDGDTOCIJZQIF-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 119.55 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze azetidine-3-carbonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azetidine-3-carbonyl chloride?
The IUPAC name of azetidine-3-carbonyl chloride (CID 154252527) is azetidine-3-carbonyl chloride.
What is the SMILES notation for azetidine-3-carbonyl chloride?
The canonical SMILES for azetidine-3-carbonyl chloride is O=C(Cl)C1CNC1.
What is the InChIKey of azetidine-3-carbonyl chloride?
The InChIKey is HEDGDTOCIJZQIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6ClNO/c5-4(7)3-1-6-2-3/h3,6H,1-2H2.
What are the key properties of azetidine-3-carbonyl chloride?
azetidine-3-carbonyl chloride has a molecular weight of 119.55 g/mol, XLogP of -0.03, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for azetidine-3-carbonyl chloride is sourced from PubChem (CID 154252527), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).