About azetidine-3-carboxylate;tert-butylazanium
azetidine-3-carboxylate;tert-butylazanium (PubChem CID 162190056) has the molecular formula C8H18N2O2
and a molecular weight of 174.24 g/mol. Its IUPAC name is azetidine-3-carboxylate;tert-butylazanium.
Molecular Properties
| Compound Name | azetidine-3-carboxylate;tert-butylazanium |
| PubChem CID | 162190056 |
| Molecular Formula | C8H18N2O2 |
| Molecular Weight | 174.24 g/mol |
| Exact Mass | 174.14 |
| IUPAC Name | azetidine-3-carboxylate;tert-butylazanium |
| SMILES | CC(C)(C)[NH3+].O=C([O-])C1CNC1 |
| InChI | InChI=1S/C4H7NO2.C4H11N/c6-4(7)3-1-5-2-3;1-4(2,3)5/h3,5H,1-2H2,(H,6,7);5H2,1-3H3 |
| InChIKey | ZQEGQJOXWXEHJA-UHFFFAOYSA-N |
| XLogP | -2.02 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.24 |
| LogP ≤ 5 | -2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze azetidine-3-carboxylate;tert-butylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azetidine-3-carboxylate;tert-butylazanium?
The IUPAC name of azetidine-3-carboxylate;tert-butylazanium (CID 162190056) is azetidine-3-carboxylate;tert-butylazanium.
What is the SMILES notation for azetidine-3-carboxylate;tert-butylazanium?
The canonical SMILES for azetidine-3-carboxylate;tert-butylazanium is CC(C)(C)[NH3+].O=C([O-])C1CNC1.
What is the InChIKey of azetidine-3-carboxylate;tert-butylazanium?
The InChIKey is ZQEGQJOXWXEHJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7NO2.C4H11N/c6-4(7)3-1-5-2-3;1-4(2,3)5/h3,5H,1-2H2,(H,6,7);5H2,1-3H3.
What are the key properties of azetidine-3-carboxylate;tert-butylazanium?
azetidine-3-carboxylate;tert-butylazanium has a molecular weight of 174.24 g/mol, XLogP of -2.02, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azetidine-3-carboxylate;tert-butylazanium is sourced from PubChem (CID 162190056), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).