C8H18N2O2 — CID 162190056
azetidine-3-carboxylate;tert-butylazanium (PubChem CID 162190056) has the molecular formula C8H18N2O2 and a molecular weight of 174.24 g/mol. Its IUPAC name is azetidine-3-carboxylate;tert-butylazanium.
| Compound Name | azetidine-3-carboxylate;tert-butylazanium |
|---|---|
| PubChem CID | 162190056 |
| Molecular Formula | C8H18N2O2 |
| Molecular Weight | 174.24 g/mol |
| Exact Mass | 174.14 |
| IUPAC Name | azetidine-3-carboxylate;tert-butylazanium |
| SMILES | CC(C)(C)[NH3+].O=C([O-])C1CNC1 |
| InChI | InChI=1S/C4H7NO2.C4H11N/c6-4(7)3-1-5-2-3;1-4(2,3)5/h3,5H,1-2H2,(H,6,7);5H2,1-3H3 |
| InChIKey | ZQEGQJOXWXEHJA-UHFFFAOYSA-N |
| XLogP | -2.02 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.24 |
| LogP ≤ 5 | -2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |