C9H18N2O4 — CID 163546448
azaniumylmethylazanium;cyclohexane-1,4-dicarboxylate (PubChem CID 163546448) has the molecular formula C9H18N2O4 and a molecular weight of 218.25 g/mol. Its IUPAC name is azaniumylmethylazanium;cyclohexane-1,4-dicarboxylate.
| Compound Name | azaniumylmethylazanium;cyclohexane-1,4-dicarboxylate |
|---|---|
| PubChem CID | 163546448 |
| Molecular Formula | C9H18N2O4 |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | azaniumylmethylazanium;cyclohexane-1,4-dicarboxylate |
| SMILES | O=C([O-])C1CCC(C(=O)[O-])CC1.[NH3+]C[NH3+] |
| InChI | InChI=1S/C8H12O4.CH6N2/c9-7(10)5-1-2-6(4-3-5)8(11)12;2-1-3/h5-6H,1-4H2,(H,9,10)(H,11,12);1-3H2 |
| InChIKey | FFKTZDXXJGVCMS-UHFFFAOYSA-N |
| XLogP | -4.28 |
| TPSA | 135.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | -4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|