About azetidine-3-carbonyl azetidine-3-carboxylate
azetidine-3-carbonyl azetidine-3-carboxylate (PubChem CID 57199777) has the molecular formula C8H12N2O3
and a molecular weight of 184.19 g/mol. Its IUPAC name is azetidine-3-carbonyl azetidine-3-carboxylate.
Molecular Properties
| Compound Name | azetidine-3-carbonyl azetidine-3-carboxylate |
| PubChem CID | 57199777 |
| Molecular Formula | C8H12N2O3 |
| Molecular Weight | 184.19 g/mol |
| Exact Mass | 184.08 |
| IUPAC Name | azetidine-3-carbonyl azetidine-3-carboxylate |
| SMILES | O=C(OC(=O)C1CNC1)C1CNC1 |
| InChI | InChI=1S/C8H12N2O3/c11-7(5-1-9-2-5)13-8(12)6-3-10-4-6/h5-6,9-10H,1-4H2 |
| InChIKey | OLJIWQJKLBRHDS-UHFFFAOYSA-N |
| XLogP | -1.50 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.19 |
| LogP ≤ 5 | -1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze azetidine-3-carbonyl azetidine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azetidine-3-carbonyl azetidine-3-carboxylate?
The IUPAC name of azetidine-3-carbonyl azetidine-3-carboxylate (CID 57199777) is azetidine-3-carbonyl azetidine-3-carboxylate.
What is the SMILES notation for azetidine-3-carbonyl azetidine-3-carboxylate?
The canonical SMILES for azetidine-3-carbonyl azetidine-3-carboxylate is O=C(OC(=O)C1CNC1)C1CNC1.
What is the InChIKey of azetidine-3-carbonyl azetidine-3-carboxylate?
The InChIKey is OLJIWQJKLBRHDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O3/c11-7(5-1-9-2-5)13-8(12)6-3-10-4-6/h5-6,9-10H,1-4H2.
What are the key properties of azetidine-3-carbonyl azetidine-3-carboxylate?
azetidine-3-carbonyl azetidine-3-carboxylate has a molecular weight of 184.19 g/mol, XLogP of -1.50, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for azetidine-3-carbonyl azetidine-3-carboxylate is sourced from PubChem (CID 57199777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).