C6H11Cl — CID 59618047
cis-(1S,2S)-1-chloro-2-propan-2-ylcyclopropane (PubChem CID 59618047) has the molecular formula C6H11Cl and a molecular weight of 118.61 g/mol. Its IUPAC name is cis-(1S,2S)-1-chloro-2-propan-2-ylcyclopropane.
| Compound Name | cis-(1S,2S)-1-chloro-2-propan-2-ylcyclopropane |
|---|---|
| PubChem CID | 59618047 |
| Molecular Formula | C6H11Cl |
| Molecular Weight | 118.61 g/mol |
| Exact Mass | 118.05 |
| IUPAC Name | cis-(1S,2S)-1-chloro-2-propan-2-ylcyclopropane |
| SMILES | CC(C)[C@@H]1C[C@@H]1Cl |
| InChI | InChI=1S/C6H11Cl/c1-4(2)5-3-6(5)7/h4-6H,3H2,1-2H3/t5-,6-/m0/s1 |
| InChIKey | FXRQFZDGPFNCPS-WDSKDSINSA-N |
| XLogP | 2.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 118.61 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|