C8H15Cl2N — CID 130205385
2,5-dichloro-4-propan-2-ylpiperidine (PubChem CID 130205385) has the molecular formula C8H15Cl2N and a molecular weight of 196.12 g/mol. Its IUPAC name is 2,5-dichloro-4-propan-2-ylpiperidine.
| Compound Name | 2,5-dichloro-4-propan-2-ylpiperidine |
|---|---|
| PubChem CID | 130205385 |
| Molecular Formula | C8H15Cl2N |
| Molecular Weight | 196.12 g/mol |
| Exact Mass | 195.06 |
| IUPAC Name | 2,5-dichloro-4-propan-2-ylpiperidine |
| SMILES | CC(C)C1CC(Cl)NCC1Cl |
| InChI | InChI=1S/C8H15Cl2N/c1-5(2)6-3-8(10)11-4-7(6)9/h5-8,11H,3-4H2,1-2H3 |
| InChIKey | LWOUMWJEQVXPER-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.12 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|