C13H24 — CID 153291297
(1S,4S)-2,5-di(propan-2-yl)bicyclo[2.2.1]heptane (PubChem CID 153291297) has the molecular formula C13H24 and a molecular weight of 180.33 g/mol. Its IUPAC name is (1S,4S)-2,5-di(propan-2-yl)bicyclo[2.2.1]heptane.
| Compound Name | (1S,4S)-2,5-di(propan-2-yl)bicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 153291297 |
| Molecular Formula | C13H24 |
| Molecular Weight | 180.33 g/mol |
| Exact Mass | 180.19 |
| IUPAC Name | (1S,4S)-2,5-di(propan-2-yl)bicyclo[2.2.1]heptane |
| SMILES | CC(C)C1C[C@@H]2C[C@H]1CC2C(C)C |
| InChI | InChI=1S/C13H24/c1-8(2)12-6-11-5-10(12)7-13(11)9(3)4/h8-13H,5-7H2,1-4H3/t10-,11-,12?,13?/m0/s1 |
| InChIKey | VYPKBAGUWNKRBX-ZSVAQUKISA-N |
| XLogP | 3.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.33 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |