About 10-methyl-12-propan-2-yltricyclo[7.3.1.03,7]tridecane
10-methyl-12-propan-2-yltricyclo[7.3.1.03,7]tridecane (PubChem CID 158433586) has the molecular formula C17H30
and a molecular weight of 234.43 g/mol. Its IUPAC name is 10-methyl-12-propan-2-yltricyclo[7.3.1.03,7]tridecane.
Analyze 10-methyl-12-propan-2-yltricyclo[7.3.1.03,7]tridecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-methyl-12-propan-2-yltricyclo[7.3.1.03,7]tridecane?
The IUPAC name of 10-methyl-12-propan-2-yltricyclo[7.3.1.03,7]tridecane (CID 158433586) is 10-methyl-12-propan-2-yltricyclo[7.3.1.03,7]tridecane.
What is the SMILES notation for 10-methyl-12-propan-2-yltricyclo[7.3.1.03,7]tridecane?
The canonical SMILES for 10-methyl-12-propan-2-yltricyclo[7.3.1.03,7]tridecane is CC(C)C1CC(C)C2CC3CCCC3CC1C2.
What is the InChIKey of 10-methyl-12-propan-2-yltricyclo[7.3.1.03,7]tridecane?
The InChIKey is HBYKJGKWFVLLMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H30/c1-11(2)17-7-12(3)15-8-13-5-4-6-14(13)9-16(17)10-15/h11-17H,4-10H2,1-3H3.
What are the key properties of 10-methyl-12-propan-2-yltricyclo[7.3.1.03,7]tridecane?
10-methyl-12-propan-2-yltricyclo[7.3.1.03,7]tridecane has a molecular weight of 234.43 g/mol, XLogP of 5.13, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 10-methyl-12-propan-2-yltricyclo[7.3.1.03,7]tridecane is sourced from PubChem (CID 158433586), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).