About cis-(1S,2S)-2-propan-2-ylcyclopropane-1-sulfonyl chloride
cis-(1S,2S)-2-propan-2-ylcyclopropane-1-sulfonyl chloride (PubChem CID 98092799) has the molecular formula C6H11ClO2S
and a molecular weight of 182.67 g/mol. Its IUPAC name is cis-(1S,2S)-2-propan-2-ylcyclopropane-1-sulfonyl chloride.
Molecular Properties
| Compound Name | cis-(1S,2S)-2-propan-2-ylcyclopropane-1-sulfonyl chloride |
| PubChem CID | 98092799 |
| Molecular Formula | C6H11ClO2S |
| Molecular Weight | 182.67 g/mol |
| Exact Mass | 182.02 |
| IUPAC Name | cis-(1S,2S)-2-propan-2-ylcyclopropane-1-sulfonyl chloride |
| SMILES | CC(C)[C@@H]1C[C@@H]1S(=O)(=O)Cl |
| InChI | InChI=1S/C6H11ClO2S/c1-4(2)5-3-6(5)10(7,8)9/h4-6H,3H2,1-2H3/t5-,6-/m0/s1 |
| InChIKey | OXZLFOVYZNVWAP-WDSKDSINSA-N |
| XLogP | 1.60 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.67 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze cis-(1S,2S)-2-propan-2-ylcyclopropane-1-sulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-(1S,2S)-2-propan-2-ylcyclopropane-1-sulfonyl chloride?
The IUPAC name of cis-(1S,2S)-2-propan-2-ylcyclopropane-1-sulfonyl chloride (CID 98092799) is cis-(1S,2S)-2-propan-2-ylcyclopropane-1-sulfonyl chloride.
What is the SMILES notation for cis-(1S,2S)-2-propan-2-ylcyclopropane-1-sulfonyl chloride?
The canonical SMILES for cis-(1S,2S)-2-propan-2-ylcyclopropane-1-sulfonyl chloride is CC(C)[C@@H]1C[C@@H]1S(=O)(=O)Cl.
What is the InChIKey of cis-(1S,2S)-2-propan-2-ylcyclopropane-1-sulfonyl chloride?
The InChIKey is OXZLFOVYZNVWAP-WDSKDSINSA-N. The full InChI is InChI=1S/C6H11ClO2S/c1-4(2)5-3-6(5)10(7,8)9/h4-6H,3H2,1-2H3/t5-,6-/m0/s1.
What are the key properties of cis-(1S,2S)-2-propan-2-ylcyclopropane-1-sulfonyl chloride?
cis-(1S,2S)-2-propan-2-ylcyclopropane-1-sulfonyl chloride has a molecular weight of 182.67 g/mol, XLogP of 1.60, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(1S,2S)-2-propan-2-ylcyclopropane-1-sulfonyl chloride is sourced from PubChem (CID 98092799), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).