C11H19NO2S — CID 15325099
[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]sulfonylformonitrile (PubChem CID 15325099) has the molecular formula C11H19NO2S and a molecular weight of 229.34 g/mol. Its IUPAC name is [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]sulfonylformonitrile.
| Compound Name | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]sulfonylformonitrile |
|---|---|
| PubChem CID | 15325099 |
| Molecular Formula | C11H19NO2S |
| Molecular Weight | 229.34 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]sulfonylformonitrile |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)C[C@H]1S(=O)(=O)C#N |
| InChI | InChI=1S/C11H19NO2S/c1-8(2)10-5-4-9(3)6-11(10)15(13,14)7-12/h8-11H,4-6H2,1-3H3/t9-,10+,11-/m1/s1 |
| InChIKey | OUIJQHAPEBYSHS-OUAUKWLOSA-N |
| XLogP | 2.34 |
| TPSA | 57.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.34 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'sulfonyl_cyanide', 'substructure': 'N/A'} |
|---|