C12H25IS — CID 130177362
iodo-dimethyl-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]-λ4-sulfane (PubChem CID 130177362) has the molecular formula C12H25IS and a molecular weight of 328.30 g/mol. Its IUPAC name is iodo-dimethyl-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]-λ4-sulfane.
| Compound Name | iodo-dimethyl-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]-λ4-sulfane |
|---|---|
| PubChem CID | 130177362 |
| Molecular Formula | C12H25IS |
| Molecular Weight | 328.30 g/mol |
| Exact Mass | 328.07 |
| IUPAC Name | iodo-dimethyl-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]-λ4-sulfane |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)C[C@H]1S(C)(C)I |
| InChI | InChI=1S/C12H25IS/c1-9(2)11-7-6-10(3)8-12(11)14(4,5)13/h9-12H,6-8H2,1-5H3/t10-,11+,12-/m1/s1 |
| InChIKey | GGYJCUIZAQERNJ-GRYCIOLGSA-N |
| XLogP | 4.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.30 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|