C10H20O3S — CID 14806226
(1S,2S,5R)-5-methyl-2-propan-2-ylcyclohexane-1-sulfonic acid (PubChem CID 14806226) has the molecular formula C10H20O3S and a molecular weight of 220.33 g/mol. Its IUPAC name is (1S,2S,5R)-5-methyl-2-propan-2-ylcyclohexane-1-sulfonic acid.
| Compound Name | (1S,2S,5R)-5-methyl-2-propan-2-ylcyclohexane-1-sulfonic acid |
|---|---|
| PubChem CID | 14806226 |
| Molecular Formula | C10H20O3S |
| Molecular Weight | 220.33 g/mol |
| Exact Mass | 220.11 |
| IUPAC Name | (1S,2S,5R)-5-methyl-2-propan-2-ylcyclohexane-1-sulfonic acid |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)C[C@@H]1S(=O)(=O)O |
| InChI | InChI=1S/C10H20O3S/c1-7(2)9-5-4-8(3)6-10(9)14(11,12)13/h7-10H,4-6H2,1-3H3,(H,11,12,13)/t8-,9+,10+/m1/s1 |
| InChIKey | DCWMBEUQQVVRLL-UTLUCORTSA-N |
| XLogP | 2.34 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.33 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|