C13H26O4S — CID 87267060
3-(5-methyl-2-propan-2-ylcyclohexyl)oxypropane-1-sulfonic acid (PubChem CID 87267060) has the molecular formula C13H26O4S and a molecular weight of 278.41 g/mol. Its IUPAC name is 3-(5-methyl-2-propan-2-ylcyclohexyl)oxypropane-1-sulfonic acid.
| Compound Name | 3-(5-methyl-2-propan-2-ylcyclohexyl)oxypropane-1-sulfonic acid |
|---|---|
| PubChem CID | 87267060 |
| Molecular Formula | C13H26O4S |
| Molecular Weight | 278.41 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | 3-(5-methyl-2-propan-2-ylcyclohexyl)oxypropane-1-sulfonic acid |
| SMILES | CC1CCC(C(C)C)C(OCCCS(=O)(=O)O)C1 |
| InChI | InChI=1S/C13H26O4S/c1-10(2)12-6-5-11(3)9-13(12)17-7-4-8-18(14,15)16/h10-13H,4-9H2,1-3H3,(H,14,15,16) |
| InChIKey | JEYLXFNYQXDQGR-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.41 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|