C11H19NO — CID 124566817
(1R,2S,4R)-2-isocyanato-4-methyl-1-propan-2-ylcyclohexane (PubChem CID 124566817) has the molecular formula C11H19NO and a molecular weight of 181.28 g/mol. Its IUPAC name is (1R,2S,4R)-2-isocyanato-4-methyl-1-propan-2-ylcyclohexane.
| Compound Name | (1R,2S,4R)-2-isocyanato-4-methyl-1-propan-2-ylcyclohexane |
|---|---|
| PubChem CID | 124566817 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | (1R,2S,4R)-2-isocyanato-4-methyl-1-propan-2-ylcyclohexane |
| SMILES | CC(C)[C@H]1CC[C@@H](C)C[C@@H]1N=C=O |
| InChI | InChI=1S/C11H19NO/c1-8(2)10-5-4-9(3)6-11(10)12-7-13/h8-11H,4-6H2,1-3H3/t9-,10-,11+/m1/s1 |
| InChIKey | DALTWRUIQGCZGM-MXWKQRLJSA-N |
| XLogP | 2.78 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|