C11H22O2 — CID 162463333
cis-(1R,2S)-3,5-di(propan-2-yl)cyclopentane-1,2-diol (PubChem CID 162463333) has the molecular formula C11H22O2 and a molecular weight of 186.29 g/mol. Its IUPAC name is cis-(1R,2S)-3,5-di(propan-2-yl)cyclopentane-1,2-diol.
| Compound Name | cis-(1R,2S)-3,5-di(propan-2-yl)cyclopentane-1,2-diol |
|---|---|
| PubChem CID | 162463333 |
| Molecular Formula | C11H22O2 |
| Molecular Weight | 186.29 g/mol |
| Exact Mass | 186.16 |
| IUPAC Name | cis-(1R,2S)-3,5-di(propan-2-yl)cyclopentane-1,2-diol |
| SMILES | CC(C)C1CC(C(C)C)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C11H22O2/c1-6(2)8-5-9(7(3)4)11(13)10(8)12/h6-13H,5H2,1-4H3/t8?,9?,10-,11+ |
| InChIKey | VLWBZBQCKWKTIZ-HWACXVBKSA-N |
| XLogP | 1.66 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.29 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |