C21H38Cl2O2 — CID 157349936
2-chloro-4-methyl-1-propan-2-ylcyclohexane;[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] carbonochloridate (PubChem CID 157349936) has the molecular formula C21H38Cl2O2 and a molecular weight of 393.44 g/mol. Its IUPAC name is 2-chloro-4-methyl-1-propan-2-ylcyclohexane;[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] carbonochloridate.
| Compound Name | 2-chloro-4-methyl-1-propan-2-ylcyclohexane;[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] carbonochloridate |
|---|---|
| PubChem CID | 157349936 |
| Molecular Formula | C21H38Cl2O2 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | 2-chloro-4-methyl-1-propan-2-ylcyclohexane;[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] carbonochloridate |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)C[C@H]1OC(=O)Cl.CC1CCC(C(C)C)C(Cl)C1 |
| InChI | InChI=1S/C11H19ClO2.C10H19Cl/c1-7(2)9-5-4-8(3)6-10(9)14-11(12)13;1-7(2)9-5-4-8(3)6-10(9)11/h7-10H,4-6H2,1-3H3;7-10H,4-6H2,1-3H3/t8-,9+,10-;/m1./s1 |
| InChIKey | BHKINVHVCJFTKT-YMQJAAJZSA-N |
| XLogP | 7.51 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|