C8H15Cl — CID 23268688
(1S,2S,4S)-1-chloro-2,4-dimethylcyclohexane (PubChem CID 23268688) has the molecular formula C8H15Cl and a molecular weight of 146.66 g/mol. Its IUPAC name is (1S,2S,4S)-1-chloro-2,4-dimethylcyclohexane.
| Compound Name | (1S,2S,4S)-1-chloro-2,4-dimethylcyclohexane |
|---|---|
| PubChem CID | 23268688 |
| Molecular Formula | C8H15Cl |
| Molecular Weight | 146.66 g/mol |
| Exact Mass | 146.09 |
| IUPAC Name | (1S,2S,4S)-1-chloro-2,4-dimethylcyclohexane |
| SMILES | C[C@H]1CC[C@H](Cl)[C@@H](C)C1 |
| InChI | InChI=1S/C8H15Cl/c1-6-3-4-8(9)7(2)5-6/h6-8H,3-5H2,1-2H3/t6-,7-,8-/m0/s1 |
| InChIKey | MHTVWLFSHHHCAA-FXQIFTODSA-N |
| XLogP | 3.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.66 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|