C11H24F3N — CID 168939313
1,2-dimethyl-4-(trifluoromethyl)pyrrolidine;ethane (PubChem CID 168939313) has the molecular formula C11H24F3N and a molecular weight of 227.31 g/mol. Its IUPAC name is 1,2-dimethyl-4-(trifluoromethyl)pyrrolidine;ethane.
| Compound Name | 1,2-dimethyl-4-(trifluoromethyl)pyrrolidine;ethane |
|---|---|
| PubChem CID | 168939313 |
| Molecular Formula | C11H24F3N |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.19 |
| IUPAC Name | 1,2-dimethyl-4-(trifluoromethyl)pyrrolidine;ethane |
| SMILES | CC.CC.CC1CC(C(F)(F)F)CN1C |
| InChI | InChI=1S/C7H12F3N.2C2H6/c1-5-3-6(4-11(5)2)7(8,9)10;2*1-2/h5-6H,3-4H2,1-2H3;2*1-2H3 |
| InChIKey | JOBGOZPYWUOOSC-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |