About 4-methoxy-1,2,6-trimethylpiperidine
4-methoxy-1,2,6-trimethylpiperidine (PubChem CID 59421649) has the molecular formula C9H19NO
and a molecular weight of 157.26 g/mol. Its IUPAC name is 4-methoxy-1,2,6-trimethylpiperidine.
Molecular Properties
| Compound Name | 4-methoxy-1,2,6-trimethylpiperidine |
| PubChem CID | 59421649 |
| Molecular Formula | C9H19NO |
| Molecular Weight | 157.26 g/mol |
| Exact Mass | 157.15 |
| IUPAC Name | 4-methoxy-1,2,6-trimethylpiperidine |
| SMILES | COC1CC(C)N(C)C(C)C1 |
| InChI | InChI=1S/C9H19NO/c1-7-5-9(11-4)6-8(2)10(7)3/h7-9H,5-6H2,1-4H3 |
| InChIKey | WVKLXRDYXZVGHO-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.26 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-methoxy-1,2,6-trimethylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxy-1,2,6-trimethylpiperidine?
The IUPAC name of 4-methoxy-1,2,6-trimethylpiperidine (CID 59421649) is 4-methoxy-1,2,6-trimethylpiperidine.
What is the SMILES notation for 4-methoxy-1,2,6-trimethylpiperidine?
The canonical SMILES for 4-methoxy-1,2,6-trimethylpiperidine is COC1CC(C)N(C)C(C)C1.
What is the InChIKey of 4-methoxy-1,2,6-trimethylpiperidine?
The InChIKey is WVKLXRDYXZVGHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19NO/c1-7-5-9(11-4)6-8(2)10(7)3/h7-9H,5-6H2,1-4H3.
What are the key properties of 4-methoxy-1,2,6-trimethylpiperidine?
4-methoxy-1,2,6-trimethylpiperidine has a molecular weight of 157.26 g/mol, XLogP of 1.50, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxy-1,2,6-trimethylpiperidine is sourced from PubChem (CID 59421649), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).