About (2R,4S)-7-methoxy-9-methyl-9-azatricyclo[3.3.1.02,4]nonane
(2R,4S)-7-methoxy-9-methyl-9-azatricyclo[3.3.1.02,4]nonane (PubChem CID 126672500) has the molecular formula C10H17NO
and a molecular weight of 167.25 g/mol. Its IUPAC name is (2R,4S)-7-methoxy-9-methyl-9-azatricyclo[3.3.1.02,4]nonane.
Molecular Properties
| Compound Name | (2R,4S)-7-methoxy-9-methyl-9-azatricyclo[3.3.1.02,4]nonane |
| PubChem CID | 126672500 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | (2R,4S)-7-methoxy-9-methyl-9-azatricyclo[3.3.1.02,4]nonane |
| SMILES | COC1CC2[C@H]3C[C@H]3C(C1)N2C |
| InChI | InChI=1S/C10H17NO/c1-11-9-3-6(12-2)4-10(11)8-5-7(8)9/h6-10H,3-5H2,1-2H3/t6?,7-,8+,9?,10? |
| InChIKey | UCVRBSCRAMKGAZ-ALPUWHEMSA-N |
| XLogP | 1.11 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2R,4S)-7-methoxy-9-methyl-9-azatricyclo[3.3.1.02,4]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,4S)-7-methoxy-9-methyl-9-azatricyclo[3.3.1.02,4]nonane?
The IUPAC name of (2R,4S)-7-methoxy-9-methyl-9-azatricyclo[3.3.1.02,4]nonane (CID 126672500) is (2R,4S)-7-methoxy-9-methyl-9-azatricyclo[3.3.1.02,4]nonane.
What is the SMILES notation for (2R,4S)-7-methoxy-9-methyl-9-azatricyclo[3.3.1.02,4]nonane?
The canonical SMILES for (2R,4S)-7-methoxy-9-methyl-9-azatricyclo[3.3.1.02,4]nonane is COC1CC2[C@H]3C[C@H]3C(C1)N2C.
What is the InChIKey of (2R,4S)-7-methoxy-9-methyl-9-azatricyclo[3.3.1.02,4]nonane?
The InChIKey is UCVRBSCRAMKGAZ-ALPUWHEMSA-N. The full InChI is InChI=1S/C10H17NO/c1-11-9-3-6(12-2)4-10(11)8-5-7(8)9/h6-10H,3-5H2,1-2H3/t6?,7-,8+,9?,10?.
What are the key properties of (2R,4S)-7-methoxy-9-methyl-9-azatricyclo[3.3.1.02,4]nonane?
(2R,4S)-7-methoxy-9-methyl-9-azatricyclo[3.3.1.02,4]nonane has a molecular weight of 167.25 g/mol, XLogP of 1.11, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,4S)-7-methoxy-9-methyl-9-azatricyclo[3.3.1.02,4]nonane is sourced from PubChem (CID 126672500), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).