C9H15NO — CID 12068821
9-methyl-9-azatricyclo[3.3.1.02,4]nonan-7-ol (PubChem CID 12068821) has the molecular formula C9H15NO and a molecular weight of 153.23 g/mol. Its IUPAC name is 9-methyl-9-azatricyclo[3.3.1.02,4]nonan-7-ol.
| Compound Name | 9-methyl-9-azatricyclo[3.3.1.02,4]nonan-7-ol |
|---|---|
| PubChem CID | 12068821 |
| Molecular Formula | C9H15NO |
| Molecular Weight | 153.23 g/mol |
| Exact Mass | 153.12 |
| IUPAC Name | 9-methyl-9-azatricyclo[3.3.1.02,4]nonan-7-ol |
| SMILES | CN1C2CC(O)CC1C1CC12 |
| InChI | InChI=1S/C9H15NO/c1-10-8-2-5(11)3-9(10)7-4-6(7)8/h5-9,11H,2-4H2,1H3 |
| InChIKey | YYPPBNNLZDCVKO-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.23 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |