C10H19NO3 — CID 45096733
6,7-dimethoxy-8-methyl-8-azabicyclo[3.2.1]octan-3-ol (PubChem CID 45096733) has the molecular formula C10H19NO3 and a molecular weight of 201.27 g/mol. Its IUPAC name is 6,7-dimethoxy-8-methyl-8-azabicyclo[3.2.1]octan-3-ol.
| Compound Name | 6,7-dimethoxy-8-methyl-8-azabicyclo[3.2.1]octan-3-ol |
|---|---|
| PubChem CID | 45096733 |
| Molecular Formula | C10H19NO3 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.14 |
| IUPAC Name | 6,7-dimethoxy-8-methyl-8-azabicyclo[3.2.1]octan-3-ol |
| SMILES | COC1C(OC)C2CC(O)CC1N2C |
| InChI | InChI=1S/C10H19NO3/c1-11-7-4-6(12)5-8(11)10(14-3)9(7)13-2/h6-10,12H,4-5H2,1-3H3 |
| InChIKey | YSACPQPXZMGTEZ-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |