About cis-(1S,3R)-1,3-dimethoxycyclopentane
cis-(1S,3R)-1,3-dimethoxycyclopentane (PubChem CID 22214084) has the molecular formula C7H14O2
and a molecular weight of 130.19 g/mol. Its IUPAC name is cis-(1S,3R)-1,3-dimethoxycyclopentane.
Molecular Properties
| Compound Name | cis-(1S,3R)-1,3-dimethoxycyclopentane |
| PubChem CID | 22214084 |
| Molecular Formula | C7H14O2 |
| Molecular Weight | 130.19 g/mol |
| Exact Mass | 130.10 |
| IUPAC Name | cis-(1S,3R)-1,3-dimethoxycyclopentane |
| SMILES | CO[C@@H]1CC[C@H](OC)C1 |
| InChI | InChI=1S/C7H14O2/c1-8-6-3-4-7(5-6)9-2/h6-7H,3-5H2,1-2H3/t6-,7+ |
| InChIKey | QBRPYJDRWAUJGP-KNVOCYPGSA-N |
| XLogP | 1.20 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.19 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze cis-(1S,3R)-1,3-dimethoxycyclopentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-(1S,3R)-1,3-dimethoxycyclopentane?
The IUPAC name of cis-(1S,3R)-1,3-dimethoxycyclopentane (CID 22214084) is cis-(1S,3R)-1,3-dimethoxycyclopentane.
What is the SMILES notation for cis-(1S,3R)-1,3-dimethoxycyclopentane?
The canonical SMILES for cis-(1S,3R)-1,3-dimethoxycyclopentane is CO[C@@H]1CC[C@H](OC)C1.
What is the InChIKey of cis-(1S,3R)-1,3-dimethoxycyclopentane?
The InChIKey is QBRPYJDRWAUJGP-KNVOCYPGSA-N. The full InChI is InChI=1S/C7H14O2/c1-8-6-3-4-7(5-6)9-2/h6-7H,3-5H2,1-2H3/t6-,7+.
What are the key properties of cis-(1S,3R)-1,3-dimethoxycyclopentane?
cis-(1S,3R)-1,3-dimethoxycyclopentane has a molecular weight of 130.19 g/mol, XLogP of 1.20, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(1S,3R)-1,3-dimethoxycyclopentane is sourced from PubChem (CID 22214084), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).