C7H14ClNO — CID 118569724
(2R,4R)-1-chloro-4-methoxy-2-methylpiperidine (PubChem CID 118569724) has the molecular formula C7H14ClNO and a molecular weight of 163.65 g/mol. Its IUPAC name is (2R,4R)-1-chloro-4-methoxy-2-methylpiperidine.
| Compound Name | (2R,4R)-1-chloro-4-methoxy-2-methylpiperidine |
|---|---|
| PubChem CID | 118569724 |
| Molecular Formula | C7H14ClNO |
| Molecular Weight | 163.65 g/mol |
| Exact Mass | 163.08 |
| IUPAC Name | (2R,4R)-1-chloro-4-methoxy-2-methylpiperidine |
| SMILES | CO[C@@H]1CCN(Cl)[C@H](C)C1 |
| InChI | InChI=1S/C7H14ClNO/c1-6-5-7(10-2)3-4-9(6)8/h6-7H,3-5H2,1-2H3/t6-,7-/m1/s1 |
| InChIKey | CWSRPIPZBQKLFZ-RNFRBKRXSA-N |
| XLogP | 1.64 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.65 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|