C6H11F2N — CID 178147486
(2R,4S)-4-(difluoromethyl)-2-methylpyrrolidine (PubChem CID 178147486) has the molecular formula C6H11F2N and a molecular weight of 135.16 g/mol. Its IUPAC name is (2R,4S)-4-(difluoromethyl)-2-methylpyrrolidine.
| Compound Name | (2R,4S)-4-(difluoromethyl)-2-methylpyrrolidine |
|---|---|
| PubChem CID | 178147486 |
| Molecular Formula | C6H11F2N |
| Molecular Weight | 135.16 g/mol |
| Exact Mass | 135.09 |
| IUPAC Name | (2R,4S)-4-(difluoromethyl)-2-methylpyrrolidine |
| SMILES | C[C@@H]1C[C@H](C(F)F)CN1 |
| InChI | InChI=1S/C6H11F2N/c1-4-2-5(3-9-4)6(7)8/h4-6,9H,2-3H2,1H3/t4-,5+/m1/s1 |
| InChIKey | GHIPIVWWRHOSGE-UHNVWZDZSA-N |
| XLogP | 1.25 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 135.16 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |