C7H13F2N — CID 155904689
(2R,5R)-5-(difluoromethyl)-2-methylpiperidine (PubChem CID 155904689) has the molecular formula C7H13F2N and a molecular weight of 149.18 g/mol. Its IUPAC name is (2R,5R)-5-(difluoromethyl)-2-methylpiperidine.
| Compound Name | (2R,5R)-5-(difluoromethyl)-2-methylpiperidine |
|---|---|
| PubChem CID | 155904689 |
| Molecular Formula | C7H13F2N |
| Molecular Weight | 149.18 g/mol |
| Exact Mass | 149.10 |
| IUPAC Name | (2R,5R)-5-(difluoromethyl)-2-methylpiperidine |
| SMILES | C[C@@H]1CC[C@@H](C(F)F)CN1 |
| InChI | InChI=1S/C7H13F2N/c1-5-2-3-6(4-10-5)7(8)9/h5-7,10H,2-4H2,1H3/t5-,6-/m1/s1 |
| InChIKey | YNBPCYXUWWCTTE-PHDIDXHHSA-N |
| XLogP | 1.64 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.18 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |