About 7-fluoro-2-methylazocane
7-fluoro-2-methylazocane (PubChem CID 178025947) has the molecular formula C8H16FN
and a molecular weight of 145.22 g/mol. Its IUPAC name is 7-fluoro-2-methylazocane.
Molecular Properties
| Compound Name | 7-fluoro-2-methylazocane |
| PubChem CID | 178025947 |
| Molecular Formula | C8H16FN |
| Molecular Weight | 145.22 g/mol |
| Exact Mass | 145.13 |
| IUPAC Name | 7-fluoro-2-methylazocane |
| SMILES | CC1CCCCC(F)CN1 |
| InChI | InChI=1S/C8H16FN/c1-7-4-2-3-5-8(9)6-10-7/h7-8,10H,2-6H2,1H3 |
| InChIKey | VHJLCIKCTJMWKI-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.22 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 7-fluoro-2-methylazocane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-fluoro-2-methylazocane?
The IUPAC name of 7-fluoro-2-methylazocane (CID 178025947) is 7-fluoro-2-methylazocane.
What is the SMILES notation for 7-fluoro-2-methylazocane?
The canonical SMILES for 7-fluoro-2-methylazocane is CC1CCCCC(F)CN1.
What is the InChIKey of 7-fluoro-2-methylazocane?
The InChIKey is VHJLCIKCTJMWKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16FN/c1-7-4-2-3-5-8(9)6-10-7/h7-8,10H,2-6H2,1H3.
What are the key properties of 7-fluoro-2-methylazocane?
7-fluoro-2-methylazocane has a molecular weight of 145.22 g/mol, XLogP of 1.88, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-fluoro-2-methylazocane is sourced from PubChem (CID 178025947), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).