About 5-fluoro-2-methylazepane;hydrochloride
5-fluoro-2-methylazepane;hydrochloride (PubChem CID 166141634) has the molecular formula C7H15ClFN
and a molecular weight of 167.65 g/mol. Its IUPAC name is 5-fluoro-2-methylazepane;hydrochloride.
Molecular Properties
| Compound Name | 5-fluoro-2-methylazepane;hydrochloride |
| PubChem CID | 166141634 |
| Molecular Formula | C7H15ClFN |
| Molecular Weight | 167.65 g/mol |
| Exact Mass | 167.09 |
| IUPAC Name | 5-fluoro-2-methylazepane;hydrochloride |
| SMILES | CC1CCC(F)CCN1.Cl |
| InChI | InChI=1S/C7H14FN.ClH/c1-6-2-3-7(8)4-5-9-6;/h6-7,9H,2-5H2,1H3;1H |
| InChIKey | MDZCPJCDTJLWIT-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.65 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-fluoro-2-methylazepane;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-2-methylazepane;hydrochloride?
The IUPAC name of 5-fluoro-2-methylazepane;hydrochloride (CID 166141634) is 5-fluoro-2-methylazepane;hydrochloride.
What is the SMILES notation for 5-fluoro-2-methylazepane;hydrochloride?
The canonical SMILES for 5-fluoro-2-methylazepane;hydrochloride is CC1CCC(F)CCN1.Cl.
What is the InChIKey of 5-fluoro-2-methylazepane;hydrochloride?
The InChIKey is MDZCPJCDTJLWIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14FN.ClH/c1-6-2-3-7(8)4-5-9-6;/h6-7,9H,2-5H2,1H3;1H.
What are the key properties of 5-fluoro-2-methylazepane;hydrochloride?
5-fluoro-2-methylazepane;hydrochloride has a molecular weight of 167.65 g/mol, XLogP of 1.91, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-2-methylazepane;hydrochloride is sourced from PubChem (CID 166141634), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).