C19H39N — CID 64764075
N,5-dimethyl-2-(2-methyldecan-2-yl)cyclohexan-1-amine (PubChem CID 64764075) has the molecular formula C19H39N and a molecular weight of 281.53 g/mol. Its IUPAC name is N,5-dimethyl-2-(2-methyldecan-2-yl)cyclohexan-1-amine.
| Compound Name | N,5-dimethyl-2-(2-methyldecan-2-yl)cyclohexan-1-amine |
|---|---|
| PubChem CID | 64764075 |
| Molecular Formula | C19H39N |
| Molecular Weight | 281.53 g/mol |
| Exact Mass | 281.31 |
| IUPAC Name | N,5-dimethyl-2-(2-methyldecan-2-yl)cyclohexan-1-amine |
| SMILES | CCCCCCCCC(C)(C)C1CCC(C)CC1NC |
| InChI | InChI=1S/C19H39N/c1-6-7-8-9-10-11-14-19(3,4)17-13-12-16(2)15-18(17)20-5/h16-18,20H,6-15H2,1-5H3 |
| InChIKey | STIWBBUFAONNMT-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.53 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|