C17H35N — CID 63403610
N,4-dimethyl-2-nonylcyclohexan-1-amine (PubChem CID 63403610) has the molecular formula C17H35N and a molecular weight of 253.47 g/mol. Its IUPAC name is N,4-dimethyl-2-nonylcyclohexan-1-amine.
| Compound Name | N,4-dimethyl-2-nonylcyclohexan-1-amine |
|---|---|
| PubChem CID | 63403610 |
| Molecular Formula | C17H35N |
| Molecular Weight | 253.47 g/mol |
| Exact Mass | 253.28 |
| IUPAC Name | N,4-dimethyl-2-nonylcyclohexan-1-amine |
| SMILES | CCCCCCCCCC1CC(C)CCC1NC |
| InChI | InChI=1S/C17H35N/c1-4-5-6-7-8-9-10-11-16-14-15(2)12-13-17(16)18-3/h15-18H,4-14H2,1-3H3 |
| InChIKey | BFAQKGGKTFJYOF-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.47 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|